C20H21N3O — CID 165076117
1H-indole-2-carbaldehyde;1-(1H-indol-2-yl)-N,N-dimethylmethanamine (PubChem CID 165076117) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is 1H-indole-2-carbaldehyde;1-(1H-indol-2-yl)-N,N-dimethylmethanamine.
| Compound Name | 1H-indole-2-carbaldehyde;1-(1H-indol-2-yl)-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 165076117 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 1H-indole-2-carbaldehyde;1-(1H-indol-2-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cc2ccccc2[nH]1.O=Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H14N2.C9H7NO/c1-13(2)8-10-7-9-5-3-4-6-11(9)12-10;11-6-8-5-7-3-1-2-4-9(7)10-8/h3-7,12H,8H2,1-2H3;1-6,10H |
| InChIKey | UIFPOPWIOCQAAD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|