C17H19N3O2 — CID 173055117
3-[3,4-bis(2-cyanoethoxymethyl)phenyl]propanenitrile (PubChem CID 173055117) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 3-[3,4-bis(2-cyanoethoxymethyl)phenyl]propanenitrile.
| Compound Name | 3-[3,4-bis(2-cyanoethoxymethyl)phenyl]propanenitrile |
|---|---|
| PubChem CID | 173055117 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-[3,4-bis(2-cyanoethoxymethyl)phenyl]propanenitrile |
| SMILES | N#CCCOCc1ccc(CCC#N)cc1COCCC#N |
| InChI | InChI=1S/C17H19N3O2/c18-7-1-4-15-5-6-16(13-21-10-2-8-19)17(12-15)14-22-11-3-9-20/h5-6,12H,1-4,10-11,13-14H2 |
| InChIKey | FFQAPASSXAWLLV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 89.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|