C9H9NO2 — CID 131075643
3-(3,5-dihydroxyphenyl)propanenitrile (PubChem CID 131075643) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is 3-(3,5-dihydroxyphenyl)propanenitrile.
| Compound Name | 3-(3,5-dihydroxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 131075643 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 3-(3,5-dihydroxyphenyl)propanenitrile |
| SMILES | N#CCCc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C9H9NO2/c10-3-1-2-7-4-8(11)6-9(12)5-7/h4-6,11-12H,1-2H2 |
| InChIKey | UFJWZFBDRAFGPA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |