About 3-(3,5-dihydroxyphenyl)propanenitrile
3-(3,5-dihydroxyphenyl)propanenitrile (PubChem CID 131075643) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is 3-(3,5-dihydroxyphenyl)propanenitrile.
Molecular Properties
| Compound Name | 3-(3,5-dihydroxyphenyl)propanenitrile |
| PubChem CID | 131075643 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 3-(3,5-dihydroxyphenyl)propanenitrile |
| SMILES | N#CCCc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C9H9NO2/c10-3-1-2-7-4-8(11)6-9(12)5-7/h4-6,11-12H,1-2H2 |
| InChIKey | UFJWZFBDRAFGPA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,5-dihydroxyphenyl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dihydroxyphenyl)propanenitrile?
The IUPAC name of 3-(3,5-dihydroxyphenyl)propanenitrile (CID 131075643) is 3-(3,5-dihydroxyphenyl)propanenitrile.
What is the SMILES notation for 3-(3,5-dihydroxyphenyl)propanenitrile?
The canonical SMILES for 3-(3,5-dihydroxyphenyl)propanenitrile is N#CCCc1cc(O)cc(O)c1.
What is the InChIKey of 3-(3,5-dihydroxyphenyl)propanenitrile?
The InChIKey is UFJWZFBDRAFGPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2/c10-3-1-2-7-4-8(11)6-9(12)5-7/h4-6,11-12H,1-2H2.
What are the key properties of 3-(3,5-dihydroxyphenyl)propanenitrile?
3-(3,5-dihydroxyphenyl)propanenitrile has a molecular weight of 163.18 g/mol, XLogP of 1.55, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dihydroxyphenyl)propanenitrile is sourced from PubChem (CID 131075643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).