C9H9NO3 — CID 130034058
3-(2,4,6-trihydroxyphenyl)propanenitrile (PubChem CID 130034058) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is 3-(2,4,6-trihydroxyphenyl)propanenitrile.
| Compound Name | 3-(2,4,6-trihydroxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 130034058 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 3-(2,4,6-trihydroxyphenyl)propanenitrile |
| SMILES | N#CCCc1c(O)cc(O)cc1O |
| InChI | InChI=1S/C9H9NO3/c10-3-1-2-7-8(12)4-6(11)5-9(7)13/h4-5,11-13H,1-2H2 |
| InChIKey | WHPBZZWFYOZTKU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |