About 3-(3,5-dimethylphenyl)propanenitrile;ethane
3-(3,5-dimethylphenyl)propanenitrile;ethane (PubChem CID 143620774) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)propanenitrile;ethane.
Molecular Properties
| Compound Name | 3-(3,5-dimethylphenyl)propanenitrile;ethane |
| PubChem CID | 143620774 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 3-(3,5-dimethylphenyl)propanenitrile;ethane |
| SMILES | CC.Cc1cc(C)cc(CCC#N)c1 |
| InChI | InChI=1S/C11H13N.C2H6/c1-9-6-10(2)8-11(7-9)4-3-5-12;1-2/h6-8H,3-4H2,1-2H3;1-2H3 |
| InChIKey | XDGDBACYHDUPFI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(3,5-dimethylphenyl)propanenitrile;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dimethylphenyl)propanenitrile;ethane?
The IUPAC name of 3-(3,5-dimethylphenyl)propanenitrile;ethane (CID 143620774) is 3-(3,5-dimethylphenyl)propanenitrile;ethane.
What is the SMILES notation for 3-(3,5-dimethylphenyl)propanenitrile;ethane?
The canonical SMILES for 3-(3,5-dimethylphenyl)propanenitrile;ethane is CC.Cc1cc(C)cc(CCC#N)c1.
What is the InChIKey of 3-(3,5-dimethylphenyl)propanenitrile;ethane?
The InChIKey is XDGDBACYHDUPFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N.C2H6/c1-9-6-10(2)8-11(7-9)4-3-5-12;1-2/h6-8H,3-4H2,1-2H3;1-2H3.
What are the key properties of 3-(3,5-dimethylphenyl)propanenitrile;ethane?
3-(3,5-dimethylphenyl)propanenitrile;ethane has a molecular weight of 189.30 g/mol, XLogP of 3.79, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dimethylphenyl)propanenitrile;ethane is sourced from PubChem (CID 143620774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).