C20H19Cl2N5O4S — CID 17305582
2-[[5-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-3-nitrophenyl)acetamide (PubChem CID 17305582) has the molecular formula C20H19Cl2N5O4S and a molecular weight of 496.38 g/mol. Its IUPAC name is 2-[[5-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-3-nitrophenyl)acetamide.
| Compound Name | 2-[[5-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 17305582 |
| Molecular Formula | C20H19Cl2N5O4S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 2-[[5-[(4-chloro-3,5-dimethylphenoxy)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(4-chloro-3-nitrophenyl)acetamide |
| SMILES | Cc1cc(OCc2nnc(SCC(=O)Nc3ccc(Cl)c([N+](=O)[O-])c3)n2C)cc(C)c1Cl |
| InChI | InChI=1S/C20H19Cl2N5O4S/c1-11-6-14(7-12(2)19(11)22)31-9-17-24-25-20(26(17)3)32-10-18(28)23-13-4-5-15(21)16(8-13)27(29)30/h4-8H,9-10H2,1-3H3,(H,23,28) |
| InChIKey | BLRQOLBURBQCKO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|