C6H6ClF2N — CID 173057297
6-chloro-4-(difluoromethyl)-1,2-dihydropyridine (PubChem CID 173057297) has the molecular formula C6H6ClF2N and a molecular weight of 165.57 g/mol. Its IUPAC name is 6-chloro-4-(difluoromethyl)-1,2-dihydropyridine.
| Compound Name | 6-chloro-4-(difluoromethyl)-1,2-dihydropyridine |
|---|---|
| PubChem CID | 173057297 |
| Molecular Formula | C6H6ClF2N |
| Molecular Weight | 165.57 g/mol |
| Exact Mass | 165.02 |
| IUPAC Name | 6-chloro-4-(difluoromethyl)-1,2-dihydropyridine |
| SMILES | FC(F)C1=CCNC(Cl)=C1 |
| InChI | InChI=1S/C6H6ClF2N/c7-5-3-4(6(8)9)1-2-10-5/h1,3,6,10H,2H2 |
| InChIKey | NSVLZRJHKAMATM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.57 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|