About 2-methylnonan-2-ylsilyl propane-1-sulfonate
2-methylnonan-2-ylsilyl propane-1-sulfonate (PubChem CID 173057671) has the molecular formula C13H30O3SSi
and a molecular weight of 294.53 g/mol. Its IUPAC name is 2-methylnonan-2-ylsilyl propane-1-sulfonate.
Molecular Properties
| Compound Name | 2-methylnonan-2-ylsilyl propane-1-sulfonate |
| PubChem CID | 173057671 |
| Molecular Formula | C13H30O3SSi |
| Molecular Weight | 294.53 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 2-methylnonan-2-ylsilyl propane-1-sulfonate |
| SMILES | CCCCCCCC(C)(C)[SiH2]OS(=O)(=O)CCC |
| InChI | InChI=1S/C13H30O3SSi/c1-5-7-8-9-10-11-13(3,4)18-16-17(14,15)12-6-2/h5-12,18H2,1-4H3 |
| InChIKey | VDCUIDXXJBLFBP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methylnonan-2-ylsilyl propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylnonan-2-ylsilyl propane-1-sulfonate?
The IUPAC name of 2-methylnonan-2-ylsilyl propane-1-sulfonate (CID 173057671) is 2-methylnonan-2-ylsilyl propane-1-sulfonate.
What is the SMILES notation for 2-methylnonan-2-ylsilyl propane-1-sulfonate?
The canonical SMILES for 2-methylnonan-2-ylsilyl propane-1-sulfonate is CCCCCCCC(C)(C)[SiH2]OS(=O)(=O)CCC.
What is the InChIKey of 2-methylnonan-2-ylsilyl propane-1-sulfonate?
The InChIKey is VDCUIDXXJBLFBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30O3SSi/c1-5-7-8-9-10-11-13(3,4)18-16-17(14,15)12-6-2/h5-12,18H2,1-4H3.
What are the key properties of 2-methylnonan-2-ylsilyl propane-1-sulfonate?
2-methylnonan-2-ylsilyl propane-1-sulfonate has a molecular weight of 294.53 g/mol, XLogP of 3.39, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylnonan-2-ylsilyl propane-1-sulfonate is sourced from PubChem (CID 173057671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).