C10H16N2O — CID 173058068
N,N-dimethyl-1-pyridin-3-yloxypropan-1-amine (PubChem CID 173058068) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N,N-dimethyl-1-pyridin-3-yloxypropan-1-amine.
| Compound Name | N,N-dimethyl-1-pyridin-3-yloxypropan-1-amine |
|---|---|
| PubChem CID | 173058068 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N,N-dimethyl-1-pyridin-3-yloxypropan-1-amine |
| SMILES | CCC(Oc1cccnc1)N(C)C |
| InChI | InChI=1S/C10H16N2O/c1-4-10(12(2)3)13-9-6-5-7-11-8-9/h5-8,10H,4H2,1-3H3 |
| InChIKey | PWOFFDMYUGRZDA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|