About pyridin-3-yl pentane-3-sulfonate
pyridin-3-yl pentane-3-sulfonate (PubChem CID 174448487) has the molecular formula C10H15NO3S
and a molecular weight of 229.30 g/mol. Its IUPAC name is pyridin-3-yl pentane-3-sulfonate.
Molecular Properties
| Compound Name | pyridin-3-yl pentane-3-sulfonate |
| PubChem CID | 174448487 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | pyridin-3-yl pentane-3-sulfonate |
| SMILES | CCC(CC)S(=O)(=O)Oc1cccnc1 |
| InChI | InChI=1S/C10H15NO3S/c1-3-10(4-2)15(12,13)14-9-6-5-7-11-8-9/h5-8,10H,3-4H2,1-2H3 |
| InChIKey | SHWVSQJBFYJULH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-3-yl pentane-3-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-yl pentane-3-sulfonate?
The IUPAC name of pyridin-3-yl pentane-3-sulfonate (CID 174448487) is pyridin-3-yl pentane-3-sulfonate.
What is the SMILES notation for pyridin-3-yl pentane-3-sulfonate?
The canonical SMILES for pyridin-3-yl pentane-3-sulfonate is CCC(CC)S(=O)(=O)Oc1cccnc1.
What is the InChIKey of pyridin-3-yl pentane-3-sulfonate?
The InChIKey is SHWVSQJBFYJULH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3S/c1-3-10(4-2)15(12,13)14-9-6-5-7-11-8-9/h5-8,10H,3-4H2,1-2H3.
What are the key properties of pyridin-3-yl pentane-3-sulfonate?
pyridin-3-yl pentane-3-sulfonate has a molecular weight of 229.30 g/mol, XLogP of 1.98, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-yl pentane-3-sulfonate is sourced from PubChem (CID 174448487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).