C6H15ClN2Si — CID 173059240
1-chloro-N,N'-diethyl-2-silylethene-1,2-diamine (PubChem CID 173059240) has the molecular formula C6H15ClN2Si and a molecular weight of 178.74 g/mol. Its IUPAC name is 1-chloro-N,N'-diethyl-2-silylethene-1,2-diamine.
| Compound Name | 1-chloro-N,N'-diethyl-2-silylethene-1,2-diamine |
|---|---|
| PubChem CID | 173059240 |
| Molecular Formula | C6H15ClN2Si |
| Molecular Weight | 178.74 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 1-chloro-N,N'-diethyl-2-silylethene-1,2-diamine |
| SMILES | CCNC([SiH3])=C(Cl)NCC |
| InChI | InChI=1S/C6H15ClN2Si/c1-3-8-5(7)6(10)9-4-2/h8-9H,3-4H2,1-2,10H3 |
| InChIKey | UIUVMCITDRPAMW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.74 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|