C8H23N3Si — CID 173059458
1-N,1-N,1-N',1-N',2-N,2-N-hexamethyl-1-silylethane-1,1,2-triamine (PubChem CID 173059458) has the molecular formula C8H23N3Si and a molecular weight of 189.38 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',2-N,2-N-hexamethyl-1-silylethane-1,1,2-triamine.
| Compound Name | 1-N,1-N,1-N',1-N',2-N,2-N-hexamethyl-1-silylethane-1,1,2-triamine |
|---|---|
| PubChem CID | 173059458 |
| Molecular Formula | C8H23N3Si |
| Molecular Weight | 189.38 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 1-N,1-N,1-N',1-N',2-N,2-N-hexamethyl-1-silylethane-1,1,2-triamine |
| SMILES | CN(C)CC([SiH3])(N(C)C)N(C)C |
| InChI | InChI=1S/C8H23N3Si/c1-9(2)7-8(12,10(3)4)11(5)6/h7H2,1-6,12H3 |
| InChIKey | LCGAVZTZROUHMN-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.38 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|