C12H17NO7 — CID 173060175
4-[1-[(2-ethoxy-2-oxoethyl)-methylamino]-1-oxopropan-2-yl]oxy-4-oxobut-2-enoic acid (PubChem CID 173060175) has the molecular formula C12H17NO7 and a molecular weight of 287.27 g/mol. Its IUPAC name is 4-[1-[(2-ethoxy-2-oxoethyl)-methylamino]-1-oxopropan-2-yl]oxy-4-oxobut-2-enoic acid.
| Compound Name | 4-[1-[(2-ethoxy-2-oxoethyl)-methylamino]-1-oxopropan-2-yl]oxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 173060175 |
| Molecular Formula | C12H17NO7 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-[1-[(2-ethoxy-2-oxoethyl)-methylamino]-1-oxopropan-2-yl]oxy-4-oxobut-2-enoic acid |
| SMILES | CCOC(=O)CN(C)C(=O)C(C)OC(=O)C=CC(=O)O |
| InChI | InChI=1S/C12H17NO7/c1-4-19-11(17)7-13(3)12(18)8(2)20-10(16)6-5-9(14)15/h5-6,8H,4,7H2,1-3H3,(H,14,15) |
| InChIKey | PLXPGDPLCAIFJU-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|