C9H12O — CID 173060819
5-ethyl-2-oxatricyclo[3.2.1.01,3]oct-3-ene (PubChem CID 173060819) has the molecular formula C9H12O and a molecular weight of 136.19 g/mol. Its IUPAC name is 5-ethyl-2-oxatricyclo[3.2.1.01,3]oct-3-ene.
| Compound Name | 5-ethyl-2-oxatricyclo[3.2.1.01,3]oct-3-ene |
|---|---|
| PubChem CID | 173060819 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 5-ethyl-2-oxatricyclo[3.2.1.01,3]oct-3-ene |
| SMILES | CCC12C=C3OC3(CC1)C2 |
| InChI | InChI=1S/C9H12O/c1-2-8-3-4-9(6-8)7(5-8)10-9/h5H,2-4,6H2,1H3 |
| InChIKey | IWWSCORJNAAMBJ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|