C13H26O4 — CID 71387490
3,3-diethyl-6,6,9,9-tetramethyl-1,2,4,5-tetraoxonane (PubChem CID 71387490) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is 3,3-diethyl-6,6,9,9-tetramethyl-1,2,4,5-tetraoxonane.
| Compound Name | 3,3-diethyl-6,6,9,9-tetramethyl-1,2,4,5-tetraoxonane |
|---|---|
| PubChem CID | 71387490 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 3,3-diethyl-6,6,9,9-tetramethyl-1,2,4,5-tetraoxonane |
| SMILES | CCC1(CC)OOC(C)(C)CCC(C)(C)OO1 |
| InChI | InChI=1S/C13H26O4/c1-7-13(8-2)16-14-11(3,4)9-10-12(5,6)15-17-13/h7-10H2,1-6H3 |
| InChIKey | ASRIMHLHLBQJNT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|