C30H26F3N3O4S — CID 173062272
5-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethyl)-2-[[[2-[4-(trifluoromethoxy)phenoxy]acetyl]amino]methyl]-1,3-thiazole-4-carboxamide (PubChem CID 173062272) has the molecular formula C30H26F3N3O4S and a molecular weight of 581.62 g/mol. Its IUPAC name is 5-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethyl)-2-[[[2-[4-(trifluoromethoxy)phenoxy]acetyl]amino]methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 5-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethyl)-2-[[[2-[4-(trifluoromethoxy)phenoxy]acetyl]amino]methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 173062272 |
| Molecular Formula | C30H26F3N3O4S |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | 5-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylmethyl)-2-[[[2-[4-(trifluoromethoxy)phenoxy]acetyl]amino]methyl]-1,3-thiazole-4-carboxamide |
| SMILES | NC(=O)c1nc(CNC(=O)COc2ccc(OC(F)(F)F)cc2)sc1CC1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C30H26F3N3O4S/c31-30(32,33)40-21-13-11-20(12-14-21)39-17-26(37)35-16-27-36-28(29(34)38)25(41-27)15-24-22-7-3-1-5-18(22)9-10-19-6-2-4-8-23(19)24/h1-8,11-14,24H,9-10,15-17H2,(H2,34,38)(H,35,37) |
| InChIKey | YYZYGDCGPJODFP-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |