C10H12LiNO4 — CID 173066135
lithium;2-(4-acetyl-3-aminophenoxy)acetic acid;hydride (PubChem CID 173066135) has the molecular formula C10H12LiNO4 and a molecular weight of 217.15 g/mol. Its IUPAC name is lithium;2-(4-acetyl-3-aminophenoxy)acetic acid;hydride.
| Compound Name | lithium;2-(4-acetyl-3-aminophenoxy)acetic acid;hydride |
|---|---|
| PubChem CID | 173066135 |
| Molecular Formula | C10H12LiNO4 |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | lithium;2-(4-acetyl-3-aminophenoxy)acetic acid;hydride |
| SMILES | CC(=O)c1ccc(OCC(=O)O)cc1N.[H-].[Li+] |
| InChI | InChI=1S/C10H11NO4.Li.H/c1-6(12)8-3-2-7(4-9(8)11)15-5-10(13)14;;/h2-4H,5,11H2,1H3,(H,13,14);;/q;+1;-1 |
| InChIKey | JZVBBVFVMOWTEN-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|