C10H11N3O5 — CID 113497358
2-amino-4-[2-(carbamoylamino)-2-oxoethoxy]benzoic acid (PubChem CID 113497358) has the molecular formula C10H11N3O5 and a molecular weight of 253.21 g/mol. Its IUPAC name is 2-amino-4-[2-(carbamoylamino)-2-oxoethoxy]benzoic acid.
| Compound Name | 2-amino-4-[2-(carbamoylamino)-2-oxoethoxy]benzoic acid |
|---|---|
| PubChem CID | 113497358 |
| Molecular Formula | C10H11N3O5 |
| Molecular Weight | 253.21 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-amino-4-[2-(carbamoylamino)-2-oxoethoxy]benzoic acid |
| SMILES | NC(=O)NC(=O)COc1ccc(C(=O)O)c(N)c1 |
| InChI | InChI=1S/C10H11N3O5/c11-7-3-5(1-2-6(7)9(15)16)18-4-8(14)13-10(12)17/h1-3H,4,11H2,(H,15,16)(H3,12,13,14,17) |
| InChIKey | VGXYMQZZNZBBES-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.21 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|