C8H8N2O5S — CID 66437104
4-[2-(carbamoylamino)-2-oxoethoxy]thiophene-2-carboxylic acid (PubChem CID 66437104) has the molecular formula C8H8N2O5S and a molecular weight of 244.23 g/mol. Its IUPAC name is 4-[2-(carbamoylamino)-2-oxoethoxy]thiophene-2-carboxylic acid.
| Compound Name | 4-[2-(carbamoylamino)-2-oxoethoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 66437104 |
| Molecular Formula | C8H8N2O5S |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 4-[2-(carbamoylamino)-2-oxoethoxy]thiophene-2-carboxylic acid |
| SMILES | NC(=O)NC(=O)COc1csc(C(=O)O)c1 |
| InChI | InChI=1S/C8H8N2O5S/c9-8(14)10-6(11)2-15-4-1-5(7(12)13)16-3-4/h1,3H,2H2,(H,12,13)(H3,9,10,11,14) |
| InChIKey | QGMFNWOVLUWPPC-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |