C10H9NO4S — CID 66436706
4-[2-oxo-2-(prop-2-ynylamino)ethoxy]thiophene-2-carboxylic acid (PubChem CID 66436706) has the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. Its IUPAC name is 4-[2-oxo-2-(prop-2-ynylamino)ethoxy]thiophene-2-carboxylic acid.
| Compound Name | 4-[2-oxo-2-(prop-2-ynylamino)ethoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 66436706 |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 4-[2-oxo-2-(prop-2-ynylamino)ethoxy]thiophene-2-carboxylic acid |
| SMILES | C#CCNC(=O)COc1csc(C(=O)O)c1 |
| InChI | InChI=1S/C10H9NO4S/c1-2-3-11-9(12)5-15-7-4-8(10(13)14)16-6-7/h1,4,6H,3,5H2,(H,11,12)(H,13,14) |
| InChIKey | OFHXGUIINWZNQQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|