C7H18NO4P — CID 173067047
[2-(1-aminoethoxy)-3-methylbutan-2-yl]phosphonic acid (PubChem CID 173067047) has the molecular formula C7H18NO4P and a molecular weight of 211.20 g/mol. Its IUPAC name is [2-(1-aminoethoxy)-3-methylbutan-2-yl]phosphonic acid.
| Compound Name | [2-(1-aminoethoxy)-3-methylbutan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 173067047 |
| Molecular Formula | C7H18NO4P |
| Molecular Weight | 211.20 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | [2-(1-aminoethoxy)-3-methylbutan-2-yl]phosphonic acid |
| SMILES | CC(N)OC(C)(C(C)C)P(=O)(O)O |
| InChI | InChI=1S/C7H18NO4P/c1-5(2)7(4,12-6(3)8)13(9,10)11/h5-6H,8H2,1-4H3,(H2,9,10,11) |
| InChIKey | VOCLEYAPYVKUHH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|