C8H18O8P2 — CID 54307937
[2-(3-methylpentan-3-yloxy)-2-oxo-1-phosphonoethyl]phosphonic acid (PubChem CID 54307937) has the molecular formula C8H18O8P2 and a molecular weight of 304.17 g/mol. Its IUPAC name is [2-(3-methylpentan-3-yloxy)-2-oxo-1-phosphonoethyl]phosphonic acid.
| Compound Name | [2-(3-methylpentan-3-yloxy)-2-oxo-1-phosphonoethyl]phosphonic acid |
|---|---|
| PubChem CID | 54307937 |
| Molecular Formula | C8H18O8P2 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | [2-(3-methylpentan-3-yloxy)-2-oxo-1-phosphonoethyl]phosphonic acid |
| SMILES | CCC(C)(CC)OC(=O)C(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C8H18O8P2/c1-4-8(3,5-2)16-6(9)7(17(10,11)12)18(13,14)15/h7H,4-5H2,1-3H3,(H2,10,11,12)(H2,13,14,15) |
| InChIKey | SIVRFHADAXHXLC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|