About 3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate
3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate (PubChem CID 154930670) has the molecular formula C15H30O3S
and a molecular weight of 290.47 g/mol. Its IUPAC name is 3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate.
Molecular Properties
| Compound Name | 3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate |
| PubChem CID | 154930670 |
| Molecular Formula | C15H30O3S |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | 3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate |
| SMILES | CCC(C)(CC)OC(=O)C(C)OSC(C)(CC)CC |
| InChI | InChI=1S/C15H30O3S/c1-8-14(6,9-2)17-13(16)12(5)18-19-15(7,10-3)11-4/h12H,8-11H2,1-7H3 |
| InChIKey | UQZYRRNRGQVDFP-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate?
The IUPAC name of 3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate (CID 154930670) is 3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate.
What is the SMILES notation for 3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate?
The canonical SMILES for 3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate is CCC(C)(CC)OC(=O)C(C)OSC(C)(CC)CC.
What is the InChIKey of 3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate?
The InChIKey is UQZYRRNRGQVDFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O3S/c1-8-14(6,9-2)17-13(16)12(5)18-19-15(7,10-3)11-4/h12H,8-11H2,1-7H3.
What are the key properties of 3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate?
3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate has a molecular weight of 290.47 g/mol, XLogP of 4.74, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpentan-3-yl 2-(3-methylpentan-3-ylsulfanyloxy)propanoate is sourced from PubChem (CID 154930670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).