C18H36O5 — CID 130220570
[3-(3-hydroxy-3-methylpentoxy)-3-methylbutyl] 3-methylpentan-3-yl carbonate (PubChem CID 130220570) has the molecular formula C18H36O5 and a molecular weight of 332.48 g/mol. Its IUPAC name is [3-(3-hydroxy-3-methylpentoxy)-3-methylbutyl] 3-methylpentan-3-yl carbonate.
| Compound Name | [3-(3-hydroxy-3-methylpentoxy)-3-methylbutyl] 3-methylpentan-3-yl carbonate |
|---|---|
| PubChem CID | 130220570 |
| Molecular Formula | C18H36O5 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | [3-(3-hydroxy-3-methylpentoxy)-3-methylbutyl] 3-methylpentan-3-yl carbonate |
| SMILES | CCC(C)(O)CCOC(C)(C)CCOC(=O)OC(C)(CC)CC |
| InChI | InChI=1S/C18H36O5/c1-8-17(6,20)12-14-22-16(4,5)11-13-21-15(19)23-18(7,9-2)10-3/h20H,8-14H2,1-7H3 |
| InChIKey | WZFQHBUAFCNDBI-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |