About bis(1-butylsilylbutyl) 2-methylidenebutanedioate
bis(1-butylsilylbutyl) 2-methylidenebutanedioate (PubChem CID 173067145) has the molecular formula C21H42O4Si2
and a molecular weight of 414.74 g/mol. Its IUPAC name is bis(1-butylsilylbutyl) 2-methylidenebutanedioate.
Molecular Properties
| Compound Name | bis(1-butylsilylbutyl) 2-methylidenebutanedioate |
| PubChem CID | 173067145 |
| Molecular Formula | C21H42O4Si2 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | bis(1-butylsilylbutyl) 2-methylidenebutanedioate |
| SMILES | C=C(CC(=O)OC(CCC)[SiH2]CCCC)C(=O)OC(CCC)[SiH2]CCCC |
| InChI | InChI=1S/C21H42O4Si2/c1-6-10-14-26-19(12-8-3)24-18(22)16-17(5)21(23)25-20(13-9-4)27-15-11-7-2/h19-20H,5-16,26-27H2,1-4H3 |
| InChIKey | MWQDEYZMMBTYQS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis(1-butylsilylbutyl) 2-methylidenebutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-butylsilylbutyl) 2-methylidenebutanedioate?
The IUPAC name of bis(1-butylsilylbutyl) 2-methylidenebutanedioate (CID 173067145) is bis(1-butylsilylbutyl) 2-methylidenebutanedioate.
What is the SMILES notation for bis(1-butylsilylbutyl) 2-methylidenebutanedioate?
The canonical SMILES for bis(1-butylsilylbutyl) 2-methylidenebutanedioate is C=C(CC(=O)OC(CCC)[SiH2]CCCC)C(=O)OC(CCC)[SiH2]CCCC.
What is the InChIKey of bis(1-butylsilylbutyl) 2-methylidenebutanedioate?
The InChIKey is MWQDEYZMMBTYQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42O4Si2/c1-6-10-14-26-19(12-8-3)24-18(22)16-17(5)21(23)25-20(13-9-4)27-15-11-7-2/h19-20H,5-16,26-27H2,1-4H3.
What are the key properties of bis(1-butylsilylbutyl) 2-methylidenebutanedioate?
bis(1-butylsilylbutyl) 2-methylidenebutanedioate has a molecular weight of 414.74 g/mol, XLogP of 4.05, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-butylsilylbutyl) 2-methylidenebutanedioate is sourced from PubChem (CID 173067145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).