C30H23SiZr — CID 173067996
CID 173067996 (PubChem CID 173067996) has the molecular formula C30H23SiZr and a molecular weight of 502.82 g/mol.
| Compound Name | CID 173067996 |
|---|---|
| PubChem CID | 173067996 |
| Molecular Formula | C30H23SiZr |
| Molecular Weight | 502.82 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | — |
| SMILES | [C-]1=C([Si](c2ccccc2)c2ccccc2)C=CC1.[Zr+2].c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C17H14Si.C13H9.Zr/c1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;/h1-7,9-13H,8H2;1-9H;/q2*-1;+2 |
| InChIKey | UVRNKAJTHKDKFI-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.82 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|