C18H33BrN2O2 — CID 173068755
11-(3-methyl-2H-imidazol-1-yl)undecyl prop-2-enoate;hydrobromide (PubChem CID 173068755) has the molecular formula C18H33BrN2O2 and a molecular weight of 389.38 g/mol. Its IUPAC name is 11-(3-methyl-2H-imidazol-1-yl)undecyl prop-2-enoate;hydrobromide.
| Compound Name | 11-(3-methyl-2H-imidazol-1-yl)undecyl prop-2-enoate;hydrobromide |
|---|---|
| PubChem CID | 173068755 |
| Molecular Formula | C18H33BrN2O2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 11-(3-methyl-2H-imidazol-1-yl)undecyl prop-2-enoate;hydrobromide |
| SMILES | Br.C=CC(=O)OCCCCCCCCCCCN1C=CN(C)C1 |
| InChI | InChI=1S/C18H32N2O2.BrH/c1-3-18(21)22-16-12-10-8-6-4-5-7-9-11-13-20-15-14-19(2)17-20;/h3,14-15H,1,4-13,16-17H2,2H3;1H |
| InChIKey | RPOOCMSUUWXKRJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|