C23H24ClN5O4S — CID 17307287
2-[[5-[1-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide (PubChem CID 17307287) has the molecular formula C23H24ClN5O4S and a molecular weight of 502.00 g/mol. Its IUPAC name is 2-[[5-[1-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide.
| Compound Name | 2-[[5-[1-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 17307287 |
| Molecular Formula | C23H24ClN5O4S |
| Molecular Weight | 502.00 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 2-[[5-[1-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccc([N+](=O)[O-])c2)nnc1C(C)Oc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C23H24ClN5O4S/c1-5-9-28-22(16(4)33-19-10-14(2)21(24)15(3)11-19)26-27-23(28)34-13-20(30)25-17-7-6-8-18(12-17)29(31)32/h5-8,10-12,16H,1,9,13H2,2-4H3,(H,25,30) |
| InChIKey | KQWJGNLZMFEZGP-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.00 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|