C23H25ClN4O2S — CID 19641656
2-[[5-[1-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide (PubChem CID 19641656) has the molecular formula C23H25ClN4O2S and a molecular weight of 457.00 g/mol. Its IUPAC name is 2-[[5-[1-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[[5-[1-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 19641656 |
| Molecular Formula | C23H25ClN4O2S |
| Molecular Weight | 457.00 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 2-[[5-[1-(4-chloro-3,5-dimethylphenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-phenylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2)nnc1C(C)Oc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C23H25ClN4O2S/c1-5-11-28-22(17(4)30-19-12-15(2)21(24)16(3)13-19)26-27-23(28)31-14-20(29)25-18-9-7-6-8-10-18/h5-10,12-13,17H,1,11,14H2,2-4H3,(H,25,29) |
| InChIKey | KBUCSAQYKQDMEJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.00 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|