C10H17N3O4 — CID 173077949
2-methyl-N'-(2-morpholin-4-ylacetyl)propanediamide (PubChem CID 173077949) has the molecular formula C10H17N3O4 and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-methyl-N'-(2-morpholin-4-ylacetyl)propanediamide.
| Compound Name | 2-methyl-N'-(2-morpholin-4-ylacetyl)propanediamide |
|---|---|
| PubChem CID | 173077949 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 2-methyl-N'-(2-morpholin-4-ylacetyl)propanediamide |
| SMILES | CC(C(N)=O)C(=O)NC(=O)CN1CCOCC1 |
| InChI | InChI=1S/C10H17N3O4/c1-7(9(11)15)10(16)12-8(14)6-13-2-4-17-5-3-13/h7H,2-6H2,1H3,(H2,11,15)(H,12,14,16) |
| InChIKey | QRQQNTOUWUFELE-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|