About 5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole
5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole (PubChem CID 173078125) has the molecular formula C11H5F6NO2
and a molecular weight of 297.15 g/mol. Its IUPAC name is 5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole.
Molecular Properties
| Compound Name | 5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole |
| PubChem CID | 173078125 |
| Molecular Formula | C11H5F6NO2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole |
| SMILES | FC(F)(F)c1ccc(Oc2cnco2)cc1C(F)(F)F |
| InChI | InChI=1S/C11H5F6NO2/c12-10(13,14)7-2-1-6(3-8(7)11(15,16)17)20-9-4-18-5-19-9/h1-5H |
| InChIKey | KGRDYIZSQQCBCK-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole?
The IUPAC name of 5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole (CID 173078125) is 5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole.
What is the SMILES notation for 5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole?
The canonical SMILES for 5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole is FC(F)(F)c1ccc(Oc2cnco2)cc1C(F)(F)F.
What is the InChIKey of 5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole?
The InChIKey is KGRDYIZSQQCBCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5F6NO2/c12-10(13,14)7-2-1-6(3-8(7)11(15,16)17)20-9-4-18-5-19-9/h1-5H.
What are the key properties of 5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole?
5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole has a molecular weight of 297.15 g/mol, XLogP of 4.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,4-bis(trifluoromethyl)phenoxy]-1,3-oxazole is sourced from PubChem (CID 173078125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).