C11H5F6NO2 — CID 91528293
5-[2,5-bis(trifluoromethyl)phenoxy]-1,3-oxazole (PubChem CID 91528293) has the molecular formula C11H5F6NO2 and a molecular weight of 297.15 g/mol. Its IUPAC name is 5-[2,5-bis(trifluoromethyl)phenoxy]-1,3-oxazole.
| Compound Name | 5-[2,5-bis(trifluoromethyl)phenoxy]-1,3-oxazole |
|---|---|
| PubChem CID | 91528293 |
| Molecular Formula | C11H5F6NO2 |
| Molecular Weight | 297.15 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | 5-[2,5-bis(trifluoromethyl)phenoxy]-1,3-oxazole |
| SMILES | FC(F)(F)c1ccc(C(F)(F)F)c(Oc2cnco2)c1 |
| InChI | InChI=1S/C11H5F6NO2/c12-10(13,14)6-1-2-7(11(15,16)17)8(3-6)20-9-4-18-5-19-9/h1-5H |
| InChIKey | TUYWTNAUFDQLKZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.15 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |