C6H16N2O4Si — CID 173078416
dihydroxysilyl 2,6-diaminohexanoate (PubChem CID 173078416) has the molecular formula C6H16N2O4Si and a molecular weight of 208.29 g/mol. Its IUPAC name is dihydroxysilyl 2,6-diaminohexanoate.
| Compound Name | dihydroxysilyl 2,6-diaminohexanoate |
|---|---|
| PubChem CID | 173078416 |
| Molecular Formula | C6H16N2O4Si |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | dihydroxysilyl 2,6-diaminohexanoate |
| SMILES | NCCCCC(N)C(=O)O[SiH](O)O |
| InChI | InChI=1S/C6H16N2O4Si/c7-4-2-1-3-5(8)6(9)12-13(10)11/h5,10-11,13H,1-4,7-8H2 |
| InChIKey | JMRVFCROHLPEHX-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|