C25H52O8 — CID 173079010
4-O-butyl 1-O-methyl butanedioate;bis(ethane-1,2-diol);tetrakis(prop-1-ene) (PubChem CID 173079010) has the molecular formula C25H52O8 and a molecular weight of 480.68 g/mol. Its IUPAC name is 4-O-butyl 1-O-methyl butanedioate;bis(ethane-1,2-diol);tetrakis(prop-1-ene).
| Compound Name | 4-O-butyl 1-O-methyl butanedioate;bis(ethane-1,2-diol);tetrakis(prop-1-ene) |
|---|---|
| PubChem CID | 173079010 |
| Molecular Formula | C25H52O8 |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 480.37 |
| IUPAC Name | 4-O-butyl 1-O-methyl butanedioate;bis(ethane-1,2-diol);tetrakis(prop-1-ene) |
| SMILES | C=CC.C=CC.C=CC.C=CC.CCCCOC(=O)CCC(=O)OC.OCCO.OCCO |
| InChI | InChI=1S/C9H16O4.4C3H6.2C2H6O2/c1-3-4-7-13-9(11)6-5-8(10)12-2;4*1-3-2;2*3-1-2-4/h3-7H2,1-2H3;4*3H,1H2,2H3;2*3-4H,1-2H2 |
| InChIKey | ZOVFHXCJHLIUAJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|