About cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+)
cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+) (PubChem CID 173080035) has the molecular formula C27H32Zr
and a molecular weight of 447.78 g/mol. Its IUPAC name is cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+).
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+) |
| PubChem CID | 173080035 |
| Molecular Formula | C27H32Zr |
| Molecular Weight | 447.78 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+) |
| SMILES | CCCCC(=[Zr+2])CCCC.[C-]1=CC=CC1.c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C13H9.C9H18.C5H5.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-5-7-9-8-6-4-2;1-2-4-5-3-1;/h1-9H;3-8H2,1-2H3;1-3H,4H2;/q-1;;-1;+2 |
| InChIKey | DPFVZUYNFJTHHN-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.78 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+)?
The IUPAC name of cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+) (CID 173080035) is cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+).
What is the SMILES notation for cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+)?
The canonical SMILES for cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+) is CCCCC(=[Zr+2])CCCC.[C-]1=CC=CC1.c1ccc2c(c1)[cH-]c1ccccc12.
What is the InChIKey of cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+)?
The InChIKey is DPFVZUYNFJTHHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9.C9H18.C5H5.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-5-7-9-8-6-4-2;1-2-4-5-3-1;/h1-9H;3-8H2,1-2H3;1-3H,4H2;/q-1;;-1;+2.
What are the key properties of cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+)?
cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+) has a molecular weight of 447.78 g/mol, XLogP of 8.10, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+) is sourced from PubChem (CID 173080035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).