C27H32Zr — CID 173080035
cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+) (PubChem CID 173080035) has the molecular formula C27H32Zr and a molecular weight of 447.78 g/mol. Its IUPAC name is cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+).
| Compound Name | cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+) |
|---|---|
| PubChem CID | 173080035 |
| Molecular Formula | C27H32Zr |
| Molecular Weight | 447.78 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | cyclopenta-1,3-diene;9H-fluoren-9-ide;nonan-5-ylidenezirconium(2+) |
| SMILES | CCCCC(=[Zr+2])CCCC.[C-]1=CC=CC1.c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C13H9.C9H18.C5H5.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-5-7-9-8-6-4-2;1-2-4-5-3-1;/h1-9H;3-8H2,1-2H3;1-3H,4H2;/q-1;;-1;+2 |
| InChIKey | DPFVZUYNFJTHHN-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.78 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|