C9H21LiOSi — CID 173081062
lithium 2,5,5-trimethylhexan-2-yloxysilane (PubChem CID 173081062) has the molecular formula C9H21LiOSi and a molecular weight of 180.29 g/mol. Its IUPAC name is lithium 2,5,5-trimethylhexan-2-yloxysilane.
| Compound Name | lithium 2,5,5-trimethylhexan-2-yloxysilane |
|---|---|
| PubChem CID | 173081062 |
| Molecular Formula | C9H21LiOSi |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | lithium 2,5,5-trimethylhexan-2-yloxysilane |
| SMILES | CC(C)(C)[CH-]CC(C)(C)O[SiH3].[Li+] |
| InChI | InChI=1S/C9H21OSi.Li/c1-8(2,3)6-7-9(4,5)10-11;/h6H,7H2,1-5,11H3;/q-1;+1 |
| InChIKey | DAPJAWSHLATTPL-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|