C26H24Cl2F3N3O — CID 17308119
1-(3,4-dichlorophenyl)-6-(4-hexoxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine (PubChem CID 17308119) has the molecular formula C26H24Cl2F3N3O and a molecular weight of 522.40 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-6-(4-hexoxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine.
| Compound Name | 1-(3,4-dichlorophenyl)-6-(4-hexoxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 17308119 |
| Molecular Formula | C26H24Cl2F3N3O |
| Molecular Weight | 522.40 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-6-(4-hexoxyphenyl)-3-methyl-4-(trifluoromethyl)pyrazolo[5,4-b]pyridine |
| SMILES | CCCCCCOc1ccc(-c2cc(C(F)(F)F)c3c(C)nn(-c4ccc(Cl)c(Cl)c4)c3n2)cc1 |
| InChI | InChI=1S/C26H24Cl2F3N3O/c1-3-4-5-6-13-35-19-10-7-17(8-11-19)23-15-20(26(29,30)31)24-16(2)33-34(25(24)32-23)18-9-12-21(27)22(28)14-18/h7-12,14-15H,3-6,13H2,1-2H3 |
| InChIKey | CWBDVTPRDBFLBH-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.40 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|