C18H20S — CID 173084225
3,4-dimethyl-2-(3-propyl-1H-inden-2-yl)thiophene (PubChem CID 173084225) has the molecular formula C18H20S and a molecular weight of 268.43 g/mol. Its IUPAC name is 3,4-dimethyl-2-(3-propyl-1H-inden-2-yl)thiophene.
| Compound Name | 3,4-dimethyl-2-(3-propyl-1H-inden-2-yl)thiophene |
|---|---|
| PubChem CID | 173084225 |
| Molecular Formula | C18H20S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 3,4-dimethyl-2-(3-propyl-1H-inden-2-yl)thiophene |
| SMILES | CCCC1=C(c2scc(C)c2C)Cc2ccccc21 |
| InChI | InChI=1S/C18H20S/c1-4-7-16-15-9-6-5-8-14(15)10-17(16)18-13(3)12(2)11-19-18/h5-6,8-9,11H,4,7,10H2,1-3H3 |
| InChIKey | JBVDIKHIZURKOJ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |