C8H14N2O — CID 173085289
(1S,5R)-8-azabicyclo[3.2.1]octane-1-carboxamide (PubChem CID 173085289) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (1S,5R)-8-azabicyclo[3.2.1]octane-1-carboxamide.
| Compound Name | (1S,5R)-8-azabicyclo[3.2.1]octane-1-carboxamide |
|---|---|
| PubChem CID | 173085289 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (1S,5R)-8-azabicyclo[3.2.1]octane-1-carboxamide |
| SMILES | NC(=O)[C@]12CCC[C@H](CC1)N2 |
| InChI | InChI=1S/C8H14N2O/c9-7(11)8-4-1-2-6(10-8)3-5-8/h6,10H,1-5H2,(H2,9,11)/t6-,8+/m1/s1 |
| InChIKey | CULDHZPVFJXLKP-SVRRBLITSA-N |
| XLogP | 0.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |