C7H11N3O2 — CID 173085384
1-(3-hydroxypropyl)imidazole-2-carboxamide (PubChem CID 173085384) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)imidazole-2-carboxamide.
| Compound Name | 1-(3-hydroxypropyl)imidazole-2-carboxamide |
|---|---|
| PubChem CID | 173085384 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 1-(3-hydroxypropyl)imidazole-2-carboxamide |
| SMILES | NC(=O)c1nccn1CCCO |
| InChI | InChI=1S/C7H11N3O2/c8-6(12)7-9-2-4-10(7)3-1-5-11/h2,4,11H,1,3,5H2,(H2,8,12) |
| InChIKey | YTSFZXSWMRCNMX-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |