C19H21N7OS — CID 173086967
N-methyl-2-[3-[[5-[(5-methyl-1H-pyrazol-3-yl)amino]-8H-imidazo[1,2-a]pyrazin-7-yl]sulfanyl]phenyl]acetamide (PubChem CID 173086967) has the molecular formula C19H21N7OS and a molecular weight of 395.49 g/mol. Its IUPAC name is N-methyl-2-[3-[[5-[(5-methyl-1H-pyrazol-3-yl)amino]-8H-imidazo[1,2-a]pyrazin-7-yl]sulfanyl]phenyl]acetamide.
| Compound Name | N-methyl-2-[3-[[5-[(5-methyl-1H-pyrazol-3-yl)amino]-8H-imidazo[1,2-a]pyrazin-7-yl]sulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 173086967 |
| Molecular Formula | C19H21N7OS |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-methyl-2-[3-[[5-[(5-methyl-1H-pyrazol-3-yl)amino]-8H-imidazo[1,2-a]pyrazin-7-yl]sulfanyl]phenyl]acetamide |
| SMILES | CNC(=O)Cc1cccc(SN2C=C(Nc3cc(C)[nH]n3)n3ccnc3C2)c1 |
| InChI | InChI=1S/C19H21N7OS/c1-13-8-16(24-23-13)22-18-12-25(11-17-21-6-7-26(17)18)28-15-5-3-4-14(9-15)10-19(27)20-2/h3-9,12H,10-11H2,1-2H3,(H,20,27)(H2,22,23,24) |
| InChIKey | DLGLQLVRYZQIAJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|