C18H16N8OS — CID 173086796
N-(5-methyl-1H-pyrazol-3-yl)-7-[4-(1,3,4-oxadiazol-2-yl)phenyl]sulfanyl-8H-imidazo[1,2-a]pyrazin-5-amine (PubChem CID 173086796) has the molecular formula C18H16N8OS and a molecular weight of 392.45 g/mol. Its IUPAC name is N-(5-methyl-1H-pyrazol-3-yl)-7-[4-(1,3,4-oxadiazol-2-yl)phenyl]sulfanyl-8H-imidazo[1,2-a]pyrazin-5-amine.
| Compound Name | N-(5-methyl-1H-pyrazol-3-yl)-7-[4-(1,3,4-oxadiazol-2-yl)phenyl]sulfanyl-8H-imidazo[1,2-a]pyrazin-5-amine |
|---|---|
| PubChem CID | 173086796 |
| Molecular Formula | C18H16N8OS |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-(5-methyl-1H-pyrazol-3-yl)-7-[4-(1,3,4-oxadiazol-2-yl)phenyl]sulfanyl-8H-imidazo[1,2-a]pyrazin-5-amine |
| SMILES | Cc1cc(NC2=CN(Sc3ccc(-c4nnco4)cc3)Cc3nccn32)n[nH]1 |
| InChI | InChI=1S/C18H16N8OS/c1-12-8-15(23-22-12)21-17-10-25(9-16-19-6-7-26(16)17)28-14-4-2-13(3-5-14)18-24-20-11-27-18/h2-8,10-11H,9H2,1H3,(H2,21,22,23) |
| InChIKey | YPIHRPGDWMZGTH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|