C13H23N3O3 — CID 173087262
(1S,5R)-8-[(2R)-3-[formyl(methyl)amino]-2-hydroxypropyl]-8-azabicyclo[3.2.1]octane-1-carboxamide (PubChem CID 173087262) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is (1S,5R)-8-[(2R)-3-[formyl(methyl)amino]-2-hydroxypropyl]-8-azabicyclo[3.2.1]octane-1-carboxamide.
| Compound Name | (1S,5R)-8-[(2R)-3-[formyl(methyl)amino]-2-hydroxypropyl]-8-azabicyclo[3.2.1]octane-1-carboxamide |
|---|---|
| PubChem CID | 173087262 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | (1S,5R)-8-[(2R)-3-[formyl(methyl)amino]-2-hydroxypropyl]-8-azabicyclo[3.2.1]octane-1-carboxamide |
| SMILES | CN(C=O)C[C@H](O)CN1[C@@H]2CCC[C@@]1(C(N)=O)CC2 |
| InChI | InChI=1S/C13H23N3O3/c1-15(9-17)7-11(18)8-16-10-3-2-5-13(16,6-4-10)12(14)19/h9-11,18H,2-8H2,1H3,(H2,14,19)/t10-,11+,13+/m1/s1 |
| InChIKey | JDKJOLBYVNWLFI-MDZLAQPJSA-N |
| XLogP | -0.69 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|