C9H18Cl2N2O — CID 173494187
8-methyl-8-azabicyclo[3.2.1]octane-1-carboxamide;dihydrochloride (PubChem CID 173494187) has the molecular formula C9H18Cl2N2O and a molecular weight of 241.16 g/mol. Its IUPAC name is 8-methyl-8-azabicyclo[3.2.1]octane-1-carboxamide;dihydrochloride.
| Compound Name | 8-methyl-8-azabicyclo[3.2.1]octane-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 173494187 |
| Molecular Formula | C9H18Cl2N2O |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 8-methyl-8-azabicyclo[3.2.1]octane-1-carboxamide;dihydrochloride |
| SMILES | CN1C2CCCC1(C(N)=O)CC2.Cl.Cl |
| InChI | InChI=1S/C9H16N2O.2ClH/c1-11-7-3-2-5-9(11,6-4-7)8(10)12;;/h7H,2-6H2,1H3,(H2,10,12);2*1H |
| InChIKey | HWVPTVKCWBQZDT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |