C20H23ClN2O2 — CID 173089205
2-(3-aminopropyl)-6-methoxy-3-methyl-4-phenylisoquinolin-1-one;hydrochloride (PubChem CID 173089205) has the molecular formula C20H23ClN2O2 and a molecular weight of 358.87 g/mol. Its IUPAC name is 2-(3-aminopropyl)-6-methoxy-3-methyl-4-phenylisoquinolin-1-one;hydrochloride.
| Compound Name | 2-(3-aminopropyl)-6-methoxy-3-methyl-4-phenylisoquinolin-1-one;hydrochloride |
|---|---|
| PubChem CID | 173089205 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-(3-aminopropyl)-6-methoxy-3-methyl-4-phenylisoquinolin-1-one;hydrochloride |
| SMILES | COc1ccc2c(=O)n(CCCN)c(C)c(-c3ccccc3)c2c1.Cl |
| InChI | InChI=1S/C20H22N2O2.ClH/c1-14-19(15-7-4-3-5-8-15)18-13-16(24-2)9-10-17(18)20(23)22(14)12-6-11-21;/h3-5,7-10,13H,6,11-12,21H2,1-2H3;1H |
| InChIKey | ITBHMRIGTMMMCT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |