C27H25N3O2 — CID 67014281
6-methoxy-1-oxo-4-phenyl-2-[2-(2-phenylethylamino)ethyl]isoquinoline-3-carbonitrile (PubChem CID 67014281) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is 6-methoxy-1-oxo-4-phenyl-2-[2-(2-phenylethylamino)ethyl]isoquinoline-3-carbonitrile.
| Compound Name | 6-methoxy-1-oxo-4-phenyl-2-[2-(2-phenylethylamino)ethyl]isoquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 67014281 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 6-methoxy-1-oxo-4-phenyl-2-[2-(2-phenylethylamino)ethyl]isoquinoline-3-carbonitrile |
| SMILES | COc1ccc2c(=O)n(CCNCCc3ccccc3)c(C#N)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C27H25N3O2/c1-32-22-12-13-23-24(18-22)26(21-10-6-3-7-11-21)25(19-28)30(27(23)31)17-16-29-15-14-20-8-4-2-5-9-20/h2-13,18,29H,14-17H2,1H3 |
| InChIKey | VXZYOPJYZDBCNC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|