C36H37N3O3Si — CID 59389238
2-[2-amino-3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-methoxy-1-oxo-4-phenylisoquinoline-3-carbonitrile (PubChem CID 59389238) has the molecular formula C36H37N3O3Si and a molecular weight of 587.80 g/mol. Its IUPAC name is 2-[2-amino-3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-methoxy-1-oxo-4-phenylisoquinoline-3-carbonitrile.
| Compound Name | 2-[2-amino-3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-methoxy-1-oxo-4-phenylisoquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 59389238 |
| Molecular Formula | C36H37N3O3Si |
| Molecular Weight | 587.80 g/mol |
| Exact Mass | 587.26 |
| IUPAC Name | 2-[2-amino-3-[tert-butyl(diphenyl)silyl]oxypropyl]-6-methoxy-1-oxo-4-phenylisoquinoline-3-carbonitrile |
| SMILES | COc1ccc2c(=O)n(CC(N)CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)c(C#N)c(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C36H37N3O3Si/c1-36(2,3)43(29-16-10-6-11-17-29,30-18-12-7-13-19-30)42-25-27(38)24-39-33(23-37)34(26-14-8-5-9-15-26)32-22-28(41-4)20-21-31(32)35(39)40/h5-22,27H,24-25,38H2,1-4H3 |
| InChIKey | KNSFNBUQVGYMQS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.80 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|