C31H30F3N3O4 — CID 171929797
6-methoxy-1-oxo-4-phenyl-2-[2-(4-phenylbutylamino)ethyl]isoquinoline-3-carbonitrile;2,2,2-trifluoroacetic acid (PubChem CID 171929797) has the molecular formula C31H30F3N3O4 and a molecular weight of 565.59 g/mol. Its IUPAC name is 6-methoxy-1-oxo-4-phenyl-2-[2-(4-phenylbutylamino)ethyl]isoquinoline-3-carbonitrile;2,2,2-trifluoroacetic acid.
| Compound Name | 6-methoxy-1-oxo-4-phenyl-2-[2-(4-phenylbutylamino)ethyl]isoquinoline-3-carbonitrile;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171929797 |
| Molecular Formula | C31H30F3N3O4 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | 6-methoxy-1-oxo-4-phenyl-2-[2-(4-phenylbutylamino)ethyl]isoquinoline-3-carbonitrile;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc2c(=O)n(CCNCCCCc3ccccc3)c(C#N)c(-c3ccccc3)c2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H29N3O2.C2HF3O2/c1-34-24-15-16-25-26(20-24)28(23-13-6-3-7-14-23)27(21-30)32(29(25)33)19-18-31-17-9-8-12-22-10-4-2-5-11-22;3-2(4,5)1(6)7/h2-7,10-11,13-16,20,31H,8-9,12,17-19H2,1H3;(H,6,7) |
| InChIKey | QLPQDDVDSCBHDG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|