C28H24FN3O4 — CID 91056481
phenyl (2R)-2-[2-[3-cyano-4-(3-fluorophenyl)-6-methoxy-1-oxoisoquinolin-2-yl]ethylamino]propanoate (PubChem CID 91056481) has the molecular formula C28H24FN3O4 and a molecular weight of 485.52 g/mol. Its IUPAC name is phenyl (2R)-2-[2-[3-cyano-4-(3-fluorophenyl)-6-methoxy-1-oxoisoquinolin-2-yl]ethylamino]propanoate.
| Compound Name | phenyl (2R)-2-[2-[3-cyano-4-(3-fluorophenyl)-6-methoxy-1-oxoisoquinolin-2-yl]ethylamino]propanoate |
|---|---|
| PubChem CID | 91056481 |
| Molecular Formula | C28H24FN3O4 |
| Molecular Weight | 485.52 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | phenyl (2R)-2-[2-[3-cyano-4-(3-fluorophenyl)-6-methoxy-1-oxoisoquinolin-2-yl]ethylamino]propanoate |
| SMILES | COc1ccc2c(=O)n(CCN[C@H](C)C(=O)Oc3ccccc3)c(C#N)c(-c3cccc(F)c3)c2c1 |
| InChI | InChI=1S/C28H24FN3O4/c1-18(28(34)36-21-9-4-3-5-10-21)31-13-14-32-25(17-30)26(19-7-6-8-20(29)15-19)24-16-22(35-2)11-12-23(24)27(32)33/h3-12,15-16,18,31H,13-14H2,1-2H3/t18-/m1/s1 |
| InChIKey | DXOOHVOHKYHQBT-GOSISDBHSA-N |
| XLogP | 4.27 |
| TPSA | 93.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|