C20H16N2O2S — CID 173089930
3-(4-ethylthiophen-2-yl)-5-(4-phenoxyphenyl)-1,2,4-oxadiazole (PubChem CID 173089930) has the molecular formula C20H16N2O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 3-(4-ethylthiophen-2-yl)-5-(4-phenoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-(4-ethylthiophen-2-yl)-5-(4-phenoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 173089930 |
| Molecular Formula | C20H16N2O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 3-(4-ethylthiophen-2-yl)-5-(4-phenoxyphenyl)-1,2,4-oxadiazole |
| SMILES | CCc1csc(-c2noc(-c3ccc(Oc4ccccc4)cc3)n2)c1 |
| InChI | InChI=1S/C20H16N2O2S/c1-2-14-12-18(25-13-14)19-21-20(24-22-19)15-8-10-17(11-9-15)23-16-6-4-3-5-7-16/h3-13H,2H2,1H3 |
| InChIKey | KBWGAUMEGIPPDJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |